Difference between revisions of "Proteins-L-Threonines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-787 == * common-name: ** (2z,4z)-2-hydroxyhepta-2,4-dienedioate * smiles: ** c([o-])(=o)cc=cc=c(o)c(=o)[o-] * inchi-key: ** zbcbetmbs...") |
(Created page with "Category:metabolite == Metabolite Proteins-L-Threonines == * common-name: ** a [protein]-l-threonine == Reaction(s) known to consume the compound == * RXN-11890 * RX...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Proteins-L-Threonines == |
* common-name: | * common-name: | ||
− | ** | + | ** a [protein]-l-threonine |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-11890]] |
+ | * [[RXN-14906]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-11890]] | ||
+ | * [[RXN-14906]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a [protein]-l-threonine}} |
− | |||
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite Proteins-L-Threonines
- common-name:
- a [protein]-l-threonine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [protein]-l-threonine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.