Difference between revisions of "Proteins-L-Threonines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-787 == * common-name: ** (2z,4z)-2-hydroxyhepta-2,4-dienedioate * smiles: ** c([o-])(=o)cc=cc=c(o)c(=o)[o-] * inchi-key: ** zbcbetmbs...")
(Created page with "Category:metabolite == Metabolite Proteins-L-Threonines == * common-name: ** a [protein]-l-threonine == Reaction(s) known to consume the compound == * RXN-11890 * RX...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-787 ==
+
== Metabolite Proteins-L-Threonines ==
 
* common-name:
 
* common-name:
** (2z,4z)-2-hydroxyhepta-2,4-dienedioate
+
** a [protein]-l-threonine
* smiles:
 
** c([o-])(=o)cc=cc=c(o)c(=o)[o-]
 
* inchi-key:
 
** zbcbetmbsdtinl-nwjcxacmsa-l
 
* molecular-weight:
 
** 170.121
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN1K-87]]
+
* [[RXN-11890]]
 +
* [[RXN-14906]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-11890]]
 +
* [[RXN-14906]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2z,4z)-2-hydroxyhepta-2,4-dienedioate}}
+
{{#set: common-name=a [protein]-l-threonine}}
{{#set: inchi-key=inchikey=zbcbetmbsdtinl-nwjcxacmsa-l}}
 
{{#set: molecular-weight=170.121}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite Proteins-L-Threonines

  • common-name:
    • a [protein]-l-threonine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-l-threonine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.