Difference between revisions of "Proteins-With-N-Terminal-Asp"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DEOXYADENOSINE == * common-name: ** 2'-deoxyadenosine * smiles: ** c(o)c1(oc(cc(o)1)n3(c=nc2(=c(n)n=cn=c23))) * inchi-key: ** olxzpdwkrny...") |
(Created page with "Category:metabolite == Metabolite Proteins-With-N-Terminal-Asp == * common-name: ** an n-terminal l-aspartyl-[protein] == Reaction(s) known to consume the compound == * ...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Proteins-With-N-Terminal-Asp == |
* common-name: | * common-name: | ||
| − | ** | + | ** an n-terminal l-aspartyl-[protein] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-17889]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an n-terminal l-aspartyl-[protein]}} |
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite Proteins-With-N-Terminal-Asp
- common-name:
- an n-terminal l-aspartyl-[protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an n-terminal l-aspartyl-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
