Difference between revisions of "Proteins-with-incorrect-disulfides"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13025 == * common-name: ** guanosine 2'-monophosphate * smiles: ** c(o)c1(oc(c(op([o-])(=o)[o-])c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) *...") |
(Created page with "Category:metabolite == Metabolite Proteins-with-incorrect-disulfides == * common-name: ** a protein with incorrect disulfide bonds == Reaction(s) known to consume the comp...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Proteins-with-incorrect-disulfides == |
* common-name: | * common-name: | ||
| − | ** | + | ** a protein with incorrect disulfide bonds |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[5.3.4.1-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[5.3.4.1-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a protein with incorrect disulfide bonds}} |
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite Proteins-with-incorrect-disulfides
- common-name:
- a protein with incorrect disulfide bonds
