Difference between revisions of "Purine-Bases"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Menaquinols == * common-name: ** a menaquinol == Reaction(s) known to consume the compound == * RXN-14107 == Reaction(s) known to pro...") |
(Created page with "Category:metabolite == Metabolite N-METHYL-RS-TETRAHYDROBENZYLISOQUINOL == * common-name: ** n-methyl-(r,s)-tetrahydrobenzylisoquinoline * smiles: ** c[n+]1(c(c2(c(cc1)=cc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N-METHYL-RS-TETRAHYDROBENZYLISOQUINOL == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-methyl-(r,s)-tetrahydrobenzylisoquinoline |
| + | * smiles: | ||
| + | ** c[n+]1(c(c2(c(cc1)=cc=cc=2))cc3(c=cc=cc=3)) | ||
| + | * inchi-key: | ||
| + | ** vkrkvllltihdef-uhfffaoysa-o | ||
| + | * molecular-weight: | ||
| + | ** 238.352 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.1.1.115-RXN]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-methyl-(r,s)-tetrahydrobenzylisoquinoline}} |
| + | {{#set: inchi-key=inchikey=vkrkvllltihdef-uhfffaoysa-o}} | ||
| + | {{#set: molecular-weight=238.352}} | ||
Revision as of 08:26, 15 March 2021
Contents
Metabolite N-METHYL-RS-TETRAHYDROBENZYLISOQUINOL
- common-name:
- n-methyl-(r,s)-tetrahydrobenzylisoquinoline
- smiles:
- c[n+]1(c(c2(c(cc1)=cc=cc=2))cc3(c=cc=cc=3))
- inchi-key:
- vkrkvllltihdef-uhfffaoysa-o
- molecular-weight:
- 238.352
