Difference between revisions of "Purine-Bases"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-KETOLACTOSE == * common-name: ** 3'-ketolactose * smiles: ** c(o)c2(oc(oc1(c(co)oc(o)c(o)c(o)1))c(o)c(=o)c(o)2) * inchi-key: ** hkkhtab...") |
(Created page with "Category:metabolite == Metabolite Purine-Bases == * common-name: ** a purine base == Reaction(s) known to consume the compound == * PNP-RXN * RXN-14029 == Reaction...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Purine-Bases == |
* common-name: | * common-name: | ||
− | ** | + | ** a purine base |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[PNP-RXN]] |
+ | * [[RXN-14029]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[PNP-RXN]] | ||
+ | * [[PURINE-NUCLEOSIDASE-RXN]] | ||
+ | * [[RXN-14029]] | ||
+ | * [[RXN-7001]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a purine base}} |
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite Purine-Bases
- common-name:
- a purine base