Difference between revisions of "Purine-Bases"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12017 == * common-name: ** n-acetyl-serotonin sulfate * smiles: ** cc(=o)nccc1(=cnc2(=cc=c(os([o-])(=o)=o)c=c12)) * inchi-key: ** uca...") |
(Created page with "Category:metabolite == Metabolite Purine-Bases == * common-name: ** a purine base == Reaction(s) known to consume the compound == * PNP-RXN * RXN-14029 == Reaction...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Purine-Bases == |
* common-name: | * common-name: | ||
| − | ** | + | ** a purine base |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[PNP-RXN]] | ||
| + | * [[RXN-14029]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[PNP-RXN]] |
| + | * [[PURINE-NUCLEOSIDASE-RXN]] | ||
| + | * [[RXN-14029]] | ||
| + | * [[RXN-7001]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a purine base}} |
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite Purine-Bases
- common-name:
- a purine base
