Difference between revisions of "Purine-Bases"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17298 == * common-name: ** (7z,10z,13z)-sn2-monogalactosyldiacylglycerol == Reaction(s) known to consume the compound == == Reaction(...") |
(Created page with "Category:metabolite == Metabolite 3-KETOLACTOSE == * common-name: ** 3'-ketolactose * smiles: ** c(o)c2(oc(oc1(c(co)oc(o)c(o)c(o)1))c(o)c(=o)c(o)2) * inchi-key: ** hkkhtab...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-KETOLACTOSE == |
* common-name: | * common-name: | ||
| − | ** ( | + | ** 3'-ketolactose |
| + | * smiles: | ||
| + | ** c(o)c2(oc(oc1(c(co)oc(o)c(o)c(o)1))c(o)c(=o)c(o)2) | ||
| + | * inchi-key: | ||
| + | ** hkkhtabthsudbp-gihchdtpsa-n | ||
| + | * molecular-weight: | ||
| + | ** 340.283 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[KETOLACTOSE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3'-ketolactose}} |
| + | {{#set: inchi-key=inchikey=hkkhtabthsudbp-gihchdtpsa-n}} | ||
| + | {{#set: molecular-weight=340.283}} | ||
Revision as of 14:55, 5 January 2021
Contents
Metabolite 3-KETOLACTOSE
- common-name:
- 3'-ketolactose
- smiles:
- c(o)c2(oc(oc1(c(co)oc(o)c(o)c(o)1))c(o)c(=o)c(o)2)
- inchi-key:
- hkkhtabthsudbp-gihchdtpsa-n
- molecular-weight:
- 340.283
