Difference between revisions of "Purine-Deoxyribonucleosides"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10608 == * common-name: ** trans-dienelactone * smiles: ** c1(=cc(=o)oc(=cc(=o)[o-])1) * inchi-key: ** ayfxpgxazmfwnh-onegzznksa-m *...") |
(Created page with "Category:metabolite == Metabolite TROPINONE == * common-name: ** tropinone * smiles: ** c[n+]1(c2(ccc1cc(=o)c2)) * inchi-key: ** qqxldojglxjcse-knvocypgsa-o * molecular-we...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite TROPINONE == |
* common-name: | * common-name: | ||
| − | ** | + | ** tropinone |
* smiles: | * smiles: | ||
| − | ** | + | ** c[n+]1(c2(ccc1cc(=o)c2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** qqxldojglxjcse-knvocypgsa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 140.205 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[TROPINE-DEHYDROGENASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[TROPINE-DEHYDROGENASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=tropinone}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qqxldojglxjcse-knvocypgsa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=140.205}} |
Revision as of 18:58, 14 January 2021
Contents
Metabolite TROPINONE
- common-name:
- tropinone
- smiles:
- c[n+]1(c2(ccc1cc(=o)c2))
- inchi-key:
- qqxldojglxjcse-knvocypgsa-o
- molecular-weight:
- 140.205
