Difference between revisions of "Purine-Deoxyribonucleosides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10608 == * common-name: ** trans-dienelactone * smiles: ** c1(=cc(=o)oc(=cc(=o)[o-])1) * inchi-key: ** ayfxpgxazmfwnh-onegzznksa-m *...")
(Created page with "Category:metabolite == Metabolite Purine-Deoxyribonucleosides == * common-name: ** a purine 2'-deoxyribonucleoside == Reaction(s) known to consume the compound == * RXN-...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-10608 ==
+
== Metabolite Purine-Deoxyribonucleosides ==
 
* common-name:
 
* common-name:
** trans-dienelactone
+
** a purine 2'-deoxyribonucleoside
* smiles:
 
** c1(=cc(=o)oc(=cc(=o)[o-])1)
 
* inchi-key:
 
** ayfxpgxazmfwnh-onegzznksa-m
 
* molecular-weight:
 
** 139.087
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9868]]
+
* [[RXN-14029]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14029]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=trans-dienelactone}}
+
{{#set: common-name=a purine 2'-deoxyribonucleoside}}
{{#set: inchi-key=inchikey=ayfxpgxazmfwnh-onegzznksa-m}}
 
{{#set: molecular-weight=139.087}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite Purine-Deoxyribonucleosides

  • common-name:
    • a purine 2'-deoxyribonucleoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality