Difference between revisions of "Purine-Ribonucleosides"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CGMP == * common-name: ** cyclic-gmp * smiles: ** c4(c3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)op(o4)(=o)[o-])) * inchi-key: ** zoogrgp...") |
(Created page with "Category:metabolite == Metabolite Purine-Ribonucleosides == * common-name: ** a purine ribonucleoside == Reaction(s) known to consume the compound == * PNP-RXN * PUR...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Purine-Ribonucleosides == |
* common-name: | * common-name: | ||
− | ** | + | ** a purine ribonucleoside |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[PNP-RXN]] |
+ | * [[PURINE-NUCLEOSIDASE-RXN]] | ||
+ | * [[RXN-7001]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[PNP-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a purine ribonucleoside}} |
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite Purine-Ribonucleosides
- common-name:
- a purine ribonucleoside