Difference between revisions of "Pyrophosphate-inositol-phosphates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPDQT-38 == * common-name: ** 3-[(5'-methylthio)pentyl]malate * smiles: ** cscccccc(c(o)c(=o)[o-])c(=o)[o-] * inchi-key: ** ybisuhxejdgad...")
(Created page with "Category:metabolite == Metabolite CPD-14406 == * common-name: ** (2e,8z,11z,14z)-icosatetraenoyl-coa * smiles: ** cccccc=ccc=ccc=cccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPDQT-38 ==
+
== Metabolite CPD-14406 ==
 
* common-name:
 
* common-name:
** 3-[(5'-methylthio)pentyl]malate
+
** (2e,8z,11z,14z)-icosatetraenoyl-coa
 
* smiles:
 
* smiles:
** cscccccc(c(o)c(=o)[o-])c(=o)[o-]
+
** cccccc=ccc=ccc=cccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** ybisuhxejdgadq-uhfffaoysa-l
+
** wqdzfnibnfnrlf-xblgnfgosa-j
 
* molecular-weight:
 
* molecular-weight:
** 248.293
+
** 1049.959
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-18204]]
+
* [[RXN-12971]]
* [[RXNQT-4171]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-18204]]
+
* [[RXN-12969]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-[(5'-methylthio)pentyl]malate}}
+
{{#set: common-name=(2e,8z,11z,14z)-icosatetraenoyl-coa}}
{{#set: inchi-key=inchikey=ybisuhxejdgadq-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=wqdzfnibnfnrlf-xblgnfgosa-j}}
{{#set: molecular-weight=248.293}}
+
{{#set: molecular-weight=1049.959}}

Revision as of 08:28, 15 March 2021

Metabolite CPD-14406

  • common-name:
    • (2e,8z,11z,14z)-icosatetraenoyl-coa
  • smiles:
    • cccccc=ccc=ccc=cccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • wqdzfnibnfnrlf-xblgnfgosa-j
  • molecular-weight:
    • 1049.959

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality