Difference between revisions of "Pyrophosphate-inositol-phosphates"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPDQT-38 == * common-name: ** 3-[(5'-methylthio)pentyl]malate * smiles: ** cscccccc(c(o)c(=o)[o-])c(=o)[o-] * inchi-key: ** ybisuhxejdgad...") |
(Created page with "Category:metabolite == Metabolite Pyrophosphate-inositol-phosphates == * common-name: ** a pyrophosphate-containing inositol phosphate == Reaction(s) known to consume the...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Pyrophosphate-inositol-phosphates == |
* common-name: | * common-name: | ||
| − | ** | + | ** a pyrophosphate-containing inositol phosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[3.6.1.52-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[3.6.1.52-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a pyrophosphate-containing inositol phosphate}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite Pyrophosphate-inositol-phosphates
- common-name:
- a pyrophosphate-containing inositol phosphate
