Difference between revisions of "Pyrophosphate-inositol-phosphates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Primary-Amines == * common-name: ** a primary amine == Reaction(s) known to consume the compound == * ARYLAMINE-SULFOTRANSFERASE-RXN...")
(Created page with "Category:metabolite == Metabolite CPD-14123 == * common-name: ** 3-amino-2,3-dideoxy-scyllo-inosose * smiles: ** c1(c([n+])c(o)c(o)c(o)c(=o)1) * inchi-key: ** fsugckmutgkw...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Primary-Amines ==
+
== Metabolite CPD-14123 ==
 
* common-name:
 
* common-name:
** a primary amine
+
** 3-amino-2,3-dideoxy-scyllo-inosose
 +
* smiles:
 +
** c1(c([n+])c(o)c(o)c(o)c(=o)1)
 +
* inchi-key:
 +
** fsugckmutgkwie-ygivhsipsa-o
 +
* molecular-weight:
 +
** 162.165
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ARYLAMINE-SULFOTRANSFERASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ARYLAMINE-SULFOTRANSFERASE-RXN]]
+
* [[RXN-13118]]
* [[RXN-9598]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a primary amine}}
+
{{#set: common-name=3-amino-2,3-dideoxy-scyllo-inosose}}
 +
{{#set: inchi-key=inchikey=fsugckmutgkwie-ygivhsipsa-o}}
 +
{{#set: molecular-weight=162.165}}

Revision as of 14:57, 5 January 2021

Metabolite CPD-14123

  • common-name:
    • 3-amino-2,3-dideoxy-scyllo-inosose
  • smiles:
    • c1(c([n+])c(o)c(o)c(o)c(=o)1)
  • inchi-key:
    • fsugckmutgkwie-ygivhsipsa-o
  • molecular-weight:
    • 162.165

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality