Difference between revisions of "Pyrophosphate-inositol-phosphates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14123 == * common-name: ** 3-amino-2,3-dideoxy-scyllo-inosose * smiles: ** c1(c([n+])c(o)c(o)c(o)c(=o)1) * inchi-key: ** fsugckmutgkw...")
(Created page with "Category:metabolite == Metabolite CPD-19155 == * common-name: ** (s)-3-hydroxy-(9z)-hexadecenoyl-coa * smiles: ** ccccccc=ccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14123 ==
+
== Metabolite CPD-19155 ==
 
* common-name:
 
* common-name:
** 3-amino-2,3-dideoxy-scyllo-inosose
+
** (s)-3-hydroxy-(9z)-hexadecenoyl-coa
 
* smiles:
 
* smiles:
** c1(c([n+])c(o)c(o)c(o)c(=o)1)
+
** ccccccc=ccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** fsugckmutgkwie-ygivhsipsa-o
+
** zirsqpaphgzdil-vscxgisksa-j
 
* molecular-weight:
 
* molecular-weight:
** 162.165
+
** 1015.898
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17790]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13118]]
+
* [[RXN-17789]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-amino-2,3-dideoxy-scyllo-inosose}}
+
{{#set: common-name=(s)-3-hydroxy-(9z)-hexadecenoyl-coa}}
{{#set: inchi-key=inchikey=fsugckmutgkwie-ygivhsipsa-o}}
+
{{#set: inchi-key=inchikey=zirsqpaphgzdil-vscxgisksa-j}}
{{#set: molecular-weight=162.165}}
+
{{#set: molecular-weight=1015.898}}

Revision as of 15:28, 5 January 2021

Metabolite CPD-19155

  • common-name:
    • (s)-3-hydroxy-(9z)-hexadecenoyl-coa
  • smiles:
    • ccccccc=ccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • zirsqpaphgzdil-vscxgisksa-j
  • molecular-weight:
    • 1015.898

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality