Difference between revisions of "QUINATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-SUCCINYL-2-AMINO-6-KETOPIMELATE == * common-name: ** n-succinyl-2-amino-6-ketopimelate * smiles: ** c(cc(=o)c(=o)[o-])cc(nc(ccc([o-])=o...") |
(Created page with "Category:metabolite == Metabolite QUINATE == * common-name: ** l-quinate * smiles: ** c(=o)([o-])c1(o)(cc(o)c(o)c(o)c1) * inchi-key: ** aawzdtnxlsgcek-wywmibkrsa-m * molec...") |
||
(3 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite QUINATE == |
* common-name: | * common-name: | ||
− | ** | + | ** l-quinate |
* smiles: | * smiles: | ||
− | ** c | + | ** c(=o)([o-])c1(o)(cc(o)c(o)c(o)c1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** aawzdtnxlsgcek-wywmibkrsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 191.16 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-7967]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-quinate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=aawzdtnxlsgcek-wywmibkrsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=191.16}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite QUINATE
- common-name:
- l-quinate
- smiles:
- c(=o)([o-])c1(o)(cc(o)c(o)c(o)c1)
- inchi-key:
- aawzdtnxlsgcek-wywmibkrsa-m
- molecular-weight:
- 191.16