Difference between revisions of "QUINOLINATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-166 == * common-name: ** a dolichyl β-d-glucosyl phosphate == Reaction(s) known to consume the compound == * RXN-5470 * RX...")
(Created page with "Category:metabolite == Metabolite QUINOLINATE == * common-name: ** quinolinate * smiles: ** c1(=cc=c(c(c([o-])=o)=n1)c([o-])=o) * inchi-key: ** gjawhxhkyyxbsv-uhfffaoysa-l...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-166 ==
+
== Metabolite QUINOLINATE ==
 
* common-name:
 
* common-name:
** a dolichyl β-d-glucosyl phosphate
+
** quinolinate
 +
* smiles:
 +
** c1(=cc=c(c(c([o-])=o)=n1)c([o-])=o)
 +
* inchi-key:
 +
** gjawhxhkyyxbsv-uhfffaoysa-l
 +
* molecular-weight:
 +
** 165.105
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-5470]]
+
* [[QUINOPRIBOTRANS-RXN]]
* [[RXN-5471]]
 
* [[RXN-5472]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.4.1.117-RXN]]
+
* [[QUINOLINATE-SYNTHA-RXN]]
 +
* [[QUINOLINATE-SYNTHE-MULTI-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a dolichyl β-d-glucosyl phosphate}}
+
{{#set: common-name=quinolinate}}
 +
{{#set: inchi-key=inchikey=gjawhxhkyyxbsv-uhfffaoysa-l}}
 +
{{#set: molecular-weight=165.105}}

Latest revision as of 11:15, 18 March 2021

Metabolite QUINOLINATE

  • common-name:
    • quinolinate
  • smiles:
    • c1(=cc=c(c(c([o-])=o)=n1)c([o-])=o)
  • inchi-key:
    • gjawhxhkyyxbsv-uhfffaoysa-l
  • molecular-weight:
    • 165.105

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality