Difference between revisions of "QXC-ACP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-730 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate * smiles: ** ccc=ccc1(c(ccc(=o)1)cccccccc([o-])=o) * inch...") |
(Created page with "Category:metabolite == Metabolite QXC-ACP == * common-name: ** a quinoxaline-2-carboxyl-[acyl-carrier protein] == Reaction(s) known to consume the compound == == Reaction(...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite QXC-ACP == |
* common-name: | * common-name: | ||
| − | ** | + | ** a quinoxaline-2-carboxyl-[acyl-carrier protein] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-17155]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a quinoxaline-2-carboxyl-[acyl-carrier protein]}} |
| − | |||
| − | |||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite QXC-ACP
- common-name:
- a quinoxaline-2-carboxyl-[acyl-carrier protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a quinoxaline-2-carboxyl-[acyl-carrier protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
