Difference between revisions of "QXC-ACP"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GDR_LPAREN_nadp_RPAREN_m GDR_LPAREN_nadp_RPAREN_m] == * direction: ** left-to-right * common-name:...") |
(Created page with "Category:metabolite == Metabolite CPD-730 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate * smiles: ** ccc=ccc1(c(ccc(=o)1)cccccccc([o-])=o) * inch...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-730 == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate |
| − | == | + | * smiles: |
| − | + | ** ccc=ccc1(c(ccc(=o)1)cccccccc([o-])=o) | |
| − | + | * inchi-key: | |
| − | * | + | ** bzxzfdkirzbjep-jmtmcxqrsa-m |
| − | ** | + | * molecular-weight: |
| − | ** | + | ** 293.425 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | * | + | * [[12-OXOPHYTODIENOATE-REDUCTASE-RXN]] |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate}} | |
| − | {{#set: common-name= | + | {{#set: inchi-key=inchikey=bzxzfdkirzbjep-jmtmcxqrsa-m}} |
| − | + | {{#set: molecular-weight=293.425}} | |
| − | {{#set: | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | |||
Revision as of 20:36, 18 December 2020
Contents
Metabolite CPD-730
- common-name:
- 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate
- smiles:
- ccc=ccc1(c(ccc(=o)1)cccccccc([o-])=o)
- inchi-key:
- bzxzfdkirzbjep-jmtmcxqrsa-m
- molecular-weight:
- 293.425
