Difference between revisions of "QXC-ACP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-730 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate * smiles: ** ccc=ccc1(c(ccc(=o)1)cccccccc([o-])=o) * inch...") |
(Created page with "Category:metabolite == Metabolite CPD-13851 == * common-name: ** 2-hydroxy-datp * smiles: ** c(c3(c(cc(n2(c1(=c(c(n)=nc(=o)n1)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-13851 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-hydroxy-datp |
* smiles: | * smiles: | ||
| − | ** | + | ** c(c3(c(cc(n2(c1(=c(c(n)=nc(=o)n1)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** uoacbprdwrdehj-kvqbguixsa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 503.152 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN0-6957]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-hydroxy-datp}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=uoacbprdwrdehj-kvqbguixsa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=503.152}} |
Revision as of 14:59, 5 January 2021
Contents
Metabolite CPD-13851
- common-name:
- 2-hydroxy-datp
- smiles:
- c(c3(c(cc(n2(c1(=c(c(n)=nc(=o)n1)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o
- inchi-key:
- uoacbprdwrdehj-kvqbguixsa-j
- molecular-weight:
- 503.152
