Difference between revisions of "Quinones"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 16S-rRNA-guanine1516 == * common-name: ** a guanine1516 in 16s rrna == Reaction(s) known to consume the compound == * RXN0-6731 == Re...")
(Created page with "Category:metabolite == Metabolite CPD-2189 == * common-name: ** 1-18:2-2-16:2-monogalactosyldiacylglycerol * smiles: ** cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 16S-rRNA-guanine1516 ==
+
== Metabolite CPD-2189 ==
 
* common-name:
 
* common-name:
** a guanine1516 in 16s rrna
+
** 1-18:2-2-16:2-monogalactosyldiacylglycerol
 +
* smiles:
 +
** cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=cccccc)=o)=o
 +
* inchi-key:
 +
** djvqakqvqxihel-uilgywmgsa-n
 +
* molecular-weight:
 +
** 751.052
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-6731]]
+
* [[RXN-8299]]
 +
* [[RXN-8306]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a guanine1516 in 16s rrna}}
+
{{#set: common-name=1-18:2-2-16:2-monogalactosyldiacylglycerol}}
 +
{{#set: inchi-key=inchikey=djvqakqvqxihel-uilgywmgsa-n}}
 +
{{#set: molecular-weight=751.052}}

Revision as of 18:59, 14 January 2021

Metabolite CPD-2189

  • common-name:
    • 1-18:2-2-16:2-monogalactosyldiacylglycerol
  • smiles:
    • cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=cccccc)=o)=o
  • inchi-key:
    • djvqakqvqxihel-uilgywmgsa-n
  • molecular-weight:
    • 751.052

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality