Difference between revisions of "Quinones"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-2189 == * common-name: ** 1-18:2-2-16:2-monogalactosyldiacylglycerol * smiles: ** cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc...")
(Created page with "Category:metabolite == Metabolite CPDQT-29 == * common-name: ** 8-(methylthio)-2-oxooctanoate * smiles: ** csccccccc(=o)c([o-])=o * inchi-key: ** qdznkmgehahota-uhfffaoysa...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-2189 ==
+
== Metabolite CPDQT-29 ==
 
* common-name:
 
* common-name:
** 1-18:2-2-16:2-monogalactosyldiacylglycerol
+
** 8-(methylthio)-2-oxooctanoate
 
* smiles:
 
* smiles:
** cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=cccccc)=o)=o
+
** csccccccc(=o)c([o-])=o
 
* inchi-key:
 
* inchi-key:
** djvqakqvqxihel-uilgywmgsa-n
+
** qdznkmgehahota-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 751.052
+
** 203.276
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8299]]
 
* [[RXN-8306]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXNQT-4171]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:2-2-16:2-monogalactosyldiacylglycerol}}
+
{{#set: common-name=8-(methylthio)-2-oxooctanoate}}
{{#set: inchi-key=inchikey=djvqakqvqxihel-uilgywmgsa-n}}
+
{{#set: inchi-key=inchikey=qdznkmgehahota-uhfffaoysa-m}}
{{#set: molecular-weight=751.052}}
+
{{#set: molecular-weight=203.276}}

Revision as of 11:19, 15 January 2021

Metabolite CPDQT-29

  • common-name:
    • 8-(methylthio)-2-oxooctanoate
  • smiles:
    • csccccccc(=o)c([o-])=o
  • inchi-key:
    • qdznkmgehahota-uhfffaoysa-m
  • molecular-weight:
    • 203.276

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality