Difference between revisions of "R-1-AMINOPROPAN-2-YL-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ01675 == * transcription-direction: ** negative * right-end-position: ** 125317 * left-end-position: ** 112874 * centisome-position: ** 76.9536...")
(Created page with "Category:metabolite == Metabolite R-1-AMINOPROPAN-2-YL-PHOSPHATE == * common-name: ** (r)-1-amino-2-propanol o-2-phosphate * smiles: ** cc(c[n+])op(=o)([o-])[o-] * inchi-k...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ01675 ==
+
== Metabolite R-1-AMINOPROPAN-2-YL-PHOSPHATE ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** (r)-1-amino-2-propanol o-2-phosphate
−
* right-end-position:
+
* smiles:
−
** 125317
+
** cc(c[n+])op(=o)([o-])[o-]
−
* left-end-position:
+
* inchi-key:
−
** 112874
+
** ybolzujjguzudc-gsvougtgsa-m
−
* centisome-position:
+
* molecular-weight:
−
** 76.9536   
+
** 154.082
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[4.1.1.81-RXN]]
−
* [[2.7.10.1-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[orthology]]
+
{{#set: common-name=(r)-1-amino-2-propanol o-2-phosphate}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=ybolzujjguzudc-gsvougtgsa-m}}
−
* [[2.7.11.25-RXN]]
+
{{#set: molecular-weight=154.082}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[PROTEIN-KINASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=125317}}
 
−
{{#set: left-end-position=112874}}
 
−
{{#set: centisome-position=76.9536    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=3}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite R-1-AMINOPROPAN-2-YL-PHOSPHATE

  • common-name:
    • (r)-1-amino-2-propanol o-2-phosphate
  • smiles:
    • cc(c[n+])op(=o)([o-])[o-]
  • inchi-key:
    • ybolzujjguzudc-gsvougtgsa-m
  • molecular-weight:
    • 154.082

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=R-1-AMINOPROPAN-2-YL-PHOSPHATE&oldid=137816"