Difference between revisions of "R-2-HYDROXYGLUTARATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13308 RXN-13308] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...")
 
(Created page with "Category:metabolite == Metabolite R-2-HYDROXYGLUTARATE == * common-name: ** (r)-2-hydroxyglutarate * smiles: ** c(ccc(c([o-])=o)o)([o-])=o * inchi-key: ** hwxbtnavrsuojr-g...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13308 RXN-13308] ==
+
== Metabolite R-2-HYDROXYGLUTARATE ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** (r)-2-hydroxyglutarate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.3.1.93 ec-1.3.1.93]
+
** c(ccc(c([o-])=o)o)([o-])=o
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-14282]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD-10280]][c] '''+''' 1 [[NADP]][c]
+
** hwxbtnavrsuojr-gsvougtgsa-l
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
== Pathway(s) ==
+
** 146.099
−
* [[PWY-7036]], very long chain fatty acid biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7036 PWY-7036]
+
== Reaction(s) known to consume the compound ==
−
** '''14''' reactions found over '''16''' reactions in the full pathway
+
* [[KETOGLUTREDUCT-RXN]]
−
== Reconstruction information  ==
+
* [[RXN-14932]]
−
* category: [[gap-filling]]; source: [[gapfilling_solution_with_meneco_draft_medium]]; tool: [[meneco]]; comment: added for gapfilling
+
== Reaction(s) known to produce the compound ==
−
== External links  ==
+
* [[KETOGLUTREDUCT-RXN]]
−
{{#set: direction=left-to-right}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: ec-number=ec-1.3.1.93}}
+
{{#set: common-name=(r)-2-hydroxyglutarate}}
−
{{#set: nb gene associated=0}}
+
{{#set: inchi-key=inchikey=hwxbtnavrsuojr-gsvougtgsa-l}}
−
{{#set: nb pathway associated=1}}
+
{{#set: molecular-weight=146.099}}
−
{{#set: reconstruction category=gap-filling}}
 
−
{{#set: reconstruction tool=meneco}}
 
−
{{#set: reconstruction comment=added for gapfilling}}
 
−
{{#set: reconstruction source=gapfilling_solution_with_meneco_draft_medium}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite R-2-HYDROXYGLUTARATE

  • common-name:
    • (r)-2-hydroxyglutarate
  • smiles:
    • c(ccc(c([o-])=o)o)([o-])=o
  • inchi-key:
    • hwxbtnavrsuojr-gsvougtgsa-l
  • molecular-weight:
    • 146.099

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=R-2-HYDROXYGLUTARATE&oldid=138586"