Difference between revisions of "R-2-HYDROXYGLUTARATE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13308 RXN-13308] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...") |
(Created page with "Category:metabolite == Metabolite R-2-HYDROXYGLUTARATE == * common-name: ** (r)-2-hydroxyglutarate * smiles: ** c(ccc(c([o-])=o)o)([o-])=o * inchi-key: ** hwxbtnavrsuojr-g...") |
||
(9 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite R-2-HYDROXYGLUTARATE == |
− | * | + | * common-name: |
− | ** | + | ** (r)-2-hydroxyglutarate |
− | * | + | * smiles: |
− | ** [ | + | ** c(ccc(c([o-])=o)o)([o-])=o |
− | + | * inchi-key: | |
− | * | + | ** hwxbtnavrsuojr-gsvougtgsa-l |
− | + | * molecular-weight: | |
− | == | + | ** 146.099 |
− | * [[ | + | == Reaction(s) known to consume the compound == |
− | + | * [[KETOGLUTREDUCT-RXN]] | |
− | == | + | * [[RXN-14932]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | == | + | * [[KETOGLUTREDUCT-RXN]] |
− | {{#set: | + | == Reaction(s) of unknown directionality == |
− | {{#set: | + | {{#set: common-name=(r)-2-hydroxyglutarate}} |
− | + | {{#set: inchi-key=inchikey=hwxbtnavrsuojr-gsvougtgsa-l}} | |
− | + | {{#set: molecular-weight=146.099}} | |
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite R-2-HYDROXYGLUTARATE
- common-name:
- (r)-2-hydroxyglutarate
- smiles:
- c(ccc(c([o-])=o)o)([o-])=o
- inchi-key:
- hwxbtnavrsuojr-gsvougtgsa-l
- molecular-weight:
- 146.099