Difference between revisions of "R-2-HYDROXYGLUTARATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 23S-rRNA-uridine746 == * common-name: ** uridine746 in 23s rrna == Reaction(s) known to consume the compound == * RXN-11843 == Reacti...")
(Created page with "Category:metabolite == Metabolite R-2-HYDROXYGLUTARATE == * common-name: ** (r)-2-hydroxyglutarate * smiles: ** c(ccc(c([o-])=o)o)([o-])=o * inchi-key: ** hwxbtnavrsuojr-g...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 23S-rRNA-uridine746 ==
+
== Metabolite R-2-HYDROXYGLUTARATE ==
 
* common-name:
 
* common-name:
** uridine746 in 23s rrna
+
** (r)-2-hydroxyglutarate
 +
* smiles:
 +
** c(ccc(c([o-])=o)o)([o-])=o
 +
* inchi-key:
 +
** hwxbtnavrsuojr-gsvougtgsa-l
 +
* molecular-weight:
 +
** 146.099
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11843]]
+
* [[KETOGLUTREDUCT-RXN]]
 +
* [[RXN-14932]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[KETOGLUTREDUCT-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=uridine746 in 23s rrna}}
+
{{#set: common-name=(r)-2-hydroxyglutarate}}
 +
{{#set: inchi-key=inchikey=hwxbtnavrsuojr-gsvougtgsa-l}}
 +
{{#set: molecular-weight=146.099}}

Latest revision as of 11:15, 18 March 2021

Metabolite R-2-HYDROXYGLUTARATE

  • common-name:
    • (r)-2-hydroxyglutarate
  • smiles:
    • c(ccc(c([o-])=o)o)([o-])=o
  • inchi-key:
    • hwxbtnavrsuojr-gsvougtgsa-l
  • molecular-weight:
    • 146.099

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality