Difference between revisions of "R-3-hydroxy-cis-vaccenoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DCMP == * common-name: ** dcmp * smiles: ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op([o-])([o-])=o * inchi-key: ** ncmvoabpesmrcp-shyzeuofs...") |
(Created page with "Category:metabolite == Metabolite R-3-hydroxy-cis-vaccenoyl-ACPs == * common-name: ** (r)-3-hydroxy-cis-vacc-11-enoyl-[acp] == Reaction(s) known to consume the compound ==...") |
||
| (4 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite R-3-hydroxy-cis-vaccenoyl-ACPs == |
* common-name: | * common-name: | ||
| − | ** | + | ** (r)-3-hydroxy-cis-vacc-11-enoyl-[acp] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-9557]] | |
| − | |||
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-9556]] | |
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(r)-3-hydroxy-cis-vacc-11-enoyl-[acp]}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite R-3-hydroxy-cis-vaccenoyl-ACPs
- common-name:
- (r)-3-hydroxy-cis-vacc-11-enoyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "(r)-3-hydroxy-cis-vacc-11-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
