Difference between revisions of "R-3-hydroxyhexanoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GLC-D-LACTONE == * common-name: ** d-glucono-1,5-lactone * smiles: ** c(o)c1(oc(c(c(c1o)o)o)=o) * inchi-key: ** phoqvhqstubqqk-sqougzdysa...")
(Created page with "Category:metabolite == Metabolite R-3-hydroxyhexanoyl-ACPs == * common-name: ** a (3r)-3-hydroxyhexanoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9520...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GLC-D-LACTONE ==
+
== Metabolite R-3-hydroxyhexanoyl-ACPs ==
 
* common-name:
 
* common-name:
** d-glucono-1,5-lactone
+
** a (3r)-3-hydroxyhexanoyl-[acp]
* smiles:
 
** c(o)c1(oc(c(c(c1o)o)o)=o)
 
* inchi-key:
 
** phoqvhqstubqqk-sqougzdysa-n
 
* molecular-weight:
 
** 178.141
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLUCONOLACT-RXN]]
+
* [[RXN-9520]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-9518]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-glucono-1,5-lactone}}
+
{{#set: common-name=a (3r)-3-hydroxyhexanoyl-[acp]}}
{{#set: inchi-key=inchikey=phoqvhqstubqqk-sqougzdysa-n}}
 
{{#set: molecular-weight=178.141}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite R-3-hydroxyhexanoyl-ACPs

  • common-name:
    • a (3r)-3-hydroxyhexanoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a (3r)-3-hydroxyhexanoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.