Difference between revisions of "R-3-hydroxyhexanoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Detyrosinated-alpha--tubulins == * common-name: ** detyrosinated α-tubulin == Reaction(s) known to consume the compound == * 6.3....")
(Created page with "Category:metabolite == Metabolite CPD-497 == * common-name: ** pseudouridine * smiles: ** c1(nc(=o)nc(=o)c=1c2(oc(co)c(o)c(o)2)) * inchi-key: ** ptjwiqphwpfnbw-gbndhiklsa-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Detyrosinated-alpha--tubulins ==
+
== Metabolite CPD-497 ==
 
* common-name:
 
* common-name:
** detyrosinated α-tubulin
+
** pseudouridine
 +
* smiles:
 +
** c1(nc(=o)nc(=o)c=1c2(oc(co)c(o)c(o)2))
 +
* inchi-key:
 +
** ptjwiqphwpfnbw-gbndhiklsa-n
 +
* molecular-weight:
 +
** 244.204
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[6.3.2.25-RXN]]
+
* [[PSEUDOURIDINE-KINASE-RXN]]
 +
* [[RXN-15703]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-15703]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=detyrosinated α-tubulin}}
+
{{#set: common-name=pseudouridine}}
 +
{{#set: inchi-key=inchikey=ptjwiqphwpfnbw-gbndhiklsa-n}}
 +
{{#set: molecular-weight=244.204}}

Revision as of 14:58, 5 January 2021

Metabolite CPD-497

  • common-name:
    • pseudouridine
  • smiles:
    • c1(nc(=o)nc(=o)c=1c2(oc(co)c(o)c(o)2))
  • inchi-key:
    • ptjwiqphwpfnbw-gbndhiklsa-n
  • molecular-weight:
    • 244.204

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality