Difference between revisions of "R-3-hydroxymyristoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite XYLULOSE-5-PHOSPHATE == * common-name: ** d-xylulose 5-phosphate * smiles: ** c(op([o-])(=o)[o-])c(o)c(o)c(=o)co * inchi-key: ** fnzlkvnu...") |
(Created page with "Category:metabolite == Metabolite R-3-hydroxymyristoyl-ACPs == * common-name: ** a (3r)-3-hydroxymyristoyl-[acp] == Reaction(s) known to consume the compound == * RXN-95...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite R-3-hydroxymyristoyl-ACPs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a (3r)-3-hydroxymyristoyl-[acp] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-9537]] |
| − | + | * [[UDPHYDROXYMYRGLUCOSAMNACETYLTRANS-RXN]] | |
| − | * [[ | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-9536]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a (3r)-3-hydroxymyristoyl-[acp]}} |
| − | |||
| − | |||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite R-3-hydroxymyristoyl-ACPs
- common-name:
- a (3r)-3-hydroxymyristoyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a (3r)-3-hydroxymyristoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
