Difference between revisions of "R-3-hydroxystearoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15361 == * common-name: ** 3r-hydroxy-(11z)-eicos-11-enoyl-coa * smiles: ** ccccccccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)c...")
(Created page with "Category:metabolite == Metabolite R-3-hydroxystearoyl-ACPs == * common-name: ** a (3r)-3-hydroxystearoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9634...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15361 ==
+
== Metabolite R-3-hydroxystearoyl-ACPs ==
 
* common-name:
 
* common-name:
** 3r-hydroxy-(11z)-eicos-11-enoyl-coa
+
** a (3r)-3-hydroxystearoyl-[acp]
* smiles:
 
** ccccccccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** preomqknjxwclz-zhlmiuqrsa-j
 
* molecular-weight:
 
** 1072.006
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14485]]
+
* [[RXN-9634]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14484]]
+
* [[RXN-9633]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3r-hydroxy-(11z)-eicos-11-enoyl-coa}}
+
{{#set: common-name=a (3r)-3-hydroxystearoyl-[acp]}}
{{#set: inchi-key=inchikey=preomqknjxwclz-zhlmiuqrsa-j}}
 
{{#set: molecular-weight=1072.006}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite R-3-hydroxystearoyl-ACPs

  • common-name:
    • a (3r)-3-hydroxystearoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a (3r)-3-hydroxystearoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.