Difference between revisions of "R-3-hydroxystearoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ17926 == * transcription-direction: ** negative * right-end-position: ** 218960 * left-end-position: ** 201838 * centisome-position: ** 79.48975...")
(Created page with "Category:metabolite == Metabolite CPD-12014 == * common-name: ** 6-hydroxymelatonin * smiles: ** cc(=o)nccc1(=cnc2(c1=cc(oc)=c(o)c=2)) * inchi-key: ** omymrcxojjzyke-uhfff...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ17926 ==
+
== Metabolite CPD-12014 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** 6-hydroxymelatonin
−
* right-end-position:
+
* smiles:
−
** 218960
+
** cc(=o)nccc1(=cnc2(c1=cc(oc)=c(o)c=2))
−
* left-end-position:
+
* inchi-key:
−
** 201838
+
** omymrcxojjzyke-uhfffaoysa-n
−
* centisome-position:
+
* molecular-weight:
−
** 79.48975   
+
** 248.281
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-11058]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[2.7.10.1-RXN]]
+
* [[RXN-11056]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=6-hydroxymelatonin}}
−
* [[PROTEIN-KINASE-RXN]]
+
{{#set: inchi-key=inchikey=omymrcxojjzyke-uhfffaoysa-n}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=248.281}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=218960}}
 
−
{{#set: left-end-position=201838}}
 
−
{{#set: centisome-position=79.48975    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 

Revision as of 20:31, 18 December 2020

Metabolite CPD-12014

  • common-name:
    • 6-hydroxymelatonin
  • smiles:
    • cc(=o)nccc1(=cnc2(c1=cc(oc)=c(o)c=2))
  • inchi-key:
    • omymrcxojjzyke-uhfffaoysa-n
  • molecular-weight:
    • 248.281

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=R-3-hydroxystearoyl-ACPs&oldid=45956"