Difference between revisions of "R-4-PHOSPHOPANTOTHENOYL-L-CYSTEINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7673 RXN-7673] == * direction: ** reversible * common-name: ** chlorophyllide b:geranyl-geranyl...")
(Created page with "Category:metabolite == Metabolite R-4-PHOSPHOPANTOTHENOYL-L-CYSTEINE == * common-name: ** (r)-4'-phosphopantothenoyl-l-cysteine * smiles: ** cc(c)(cop(=o)([o-])[o-])c(o)c(...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7673 RXN-7673] ==
+
== Metabolite R-4-PHOSPHOPANTOTHENOYL-L-CYSTEINE ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** chlorophyllide b:geranyl-geranyl diphosphate geranyl-geranyltransferase
+
** (r)-4'-phosphopantothenoyl-l-cysteine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.5.1.62 ec-2.5.1.62]
+
** cc(c)(cop(=o)([o-])[o-])c(o)c(=o)nccc(=o)nc(cs)c(=o)[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-7014]][c] '''+''' 1 [[GERANYLGERANYL-PP]][c] '''+''' 2 [[PROTON]][c] '''<=>''' 1 [[CPD-7013]][c] '''+''' 1 [[PPI]][c]
+
** xqyalqvlcnhcft-cbapkceasa-k
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ07213]]
+
** 399.332
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[P-PANTOCYSDECARB-RXN]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
== Reconstruction information  ==
+
* [[P-PANTOCYSLIG-RXN]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== External links  ==
+
{{#set: common-name=(r)-4'-phosphopantothenoyl-l-cysteine}}
−
{{#set: direction=reversible}}
+
{{#set: inchi-key=inchikey=xqyalqvlcnhcft-cbapkceasa-k}}
−
{{#set: common-name=chlorophyllide b:geranyl-geranyl diphosphate geranyl-geranyltransferase}}
+
{{#set: molecular-weight=399.332}}
−
{{#set: ec-number=ec-2.5.1.62}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite R-4-PHOSPHOPANTOTHENOYL-L-CYSTEINE

  • common-name:
    • (r)-4'-phosphopantothenoyl-l-cysteine
  • smiles:
    • cc(c)(cop(=o)([o-])[o-])c(o)c(=o)nccc(=o)nc(cs)c(=o)[o-]
  • inchi-key:
    • xqyalqvlcnhcft-cbapkceasa-k
  • molecular-weight:
    • 399.332

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=R-4-PHOSPHOPANTOTHENOYL-L-CYSTEINE&oldid=138615"