Difference between revisions of "R-4-PHOSPHOPANTOTHENOYL-L-CYSTEINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3Z-PHYCOERYTHROBILIN == * common-name: ** (3z)-phycoerythrobilin * smiles: ** cc=c1(c(c)c(nc1=cc4(=c(c)c(ccc([o-])=o)=c(c=c2(c(ccc([o-])=...")
(Created page with "Category:metabolite == Metabolite R-4-PHOSPHOPANTOTHENOYL-L-CYSTEINE == * common-name: ** (r)-4'-phosphopantothenoyl-l-cysteine * smiles: ** cc(c)(cop(=o)([o-])[o-])c(o)c(...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite 3Z-PHYCOERYTHROBILIN ==
+
== Metabolite R-4-PHOSPHOPANTOTHENOYL-L-CYSTEINE ==
 
* common-name:
 
* common-name:
−
** (3z)-phycoerythrobilin
+
** (r)-4'-phosphopantothenoyl-l-cysteine
 
* smiles:
 
* smiles:
−
** cc=c1(c(c)c(nc1=cc4(=c(c)c(ccc([o-])=o)=c(c=c2(c(ccc([o-])=o)=c(c)c(=n2)c[ch]3(c(c)=c(c=c)c(=o)n3)))n4))=o)
+
** cc(c)(cop(=o)([o-])[o-])c(o)c(=o)nccc(=o)nc(cs)c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
−
** igjxaxffkkrfku-isrbknaysa-l
+
** xqyalqvlcnhcft-cbapkceasa-k
 
* molecular-weight:
 
* molecular-weight:
−
** 584.671
+
** 399.332
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[R05819]]
+
* [[P-PANTOCYSDECARB-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[1.3.7.3-RXN]]
+
* [[P-PANTOCYSLIG-RXN]]
−
* [[R05819]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=(3z)-phycoerythrobilin}}
+
{{#set: common-name=(r)-4'-phosphopantothenoyl-l-cysteine}}
−
{{#set: inchi-key=inchikey=igjxaxffkkrfku-isrbknaysa-l}}
+
{{#set: inchi-key=inchikey=xqyalqvlcnhcft-cbapkceasa-k}}
−
{{#set: molecular-weight=584.671}}
+
{{#set: molecular-weight=399.332}}

Latest revision as of 11:15, 18 March 2021

Metabolite R-4-PHOSPHOPANTOTHENOYL-L-CYSTEINE

  • common-name:
    • (r)-4'-phosphopantothenoyl-l-cysteine
  • smiles:
    • cc(c)(cop(=o)([o-])[o-])c(o)c(=o)nccc(=o)nc(cs)c(=o)[o-]
  • inchi-key:
    • xqyalqvlcnhcft-cbapkceasa-k
  • molecular-weight:
    • 399.332

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=R-4-PHOSPHOPANTOTHENOYL-L-CYSTEINE&oldid=138615"