Difference between revisions of "R-4-PHOSPHOPANTOTHENOYL-L-CYSTEINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DI-H-OROTATE == * common-name: ** (s)-dihydroorotate * smiles: ** c1(c(=o)nc(=o)nc(c(=o)[o-])1) * inchi-key: ** ufivepvsagbusi-reohclbhsa...") |
(Created page with "Category:metabolite == Metabolite 3Z-PHYCOERYTHROBILIN == * common-name: ** (3z)-phycoerythrobilin * smiles: ** cc=c1(c(c)c(nc1=cc4(=c(c)c(ccc([o-])=o)=c(c=c2(c(ccc([o-])=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3Z-PHYCOERYTHROBILIN == |
* common-name: | * common-name: | ||
| − | ** ( | + | ** (3z)-phycoerythrobilin |
* smiles: | * smiles: | ||
| − | ** c1(c(=o) | + | ** cc=c1(c(c)c(nc1=cc4(=c(c)c(ccc([o-])=o)=c(c=c2(c(ccc([o-])=o)=c(c)c(=n2)c[ch]3(c(c)=c(c=c)c(=o)n3)))n4))=o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** igjxaxffkkrfku-isrbknaysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 584.671 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[R05819]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[1.3.7.3-RXN]] |
| + | * [[R05819]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=( | + | {{#set: common-name=(3z)-phycoerythrobilin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=igjxaxffkkrfku-isrbknaysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=584.671}} |
Revision as of 18:56, 14 January 2021
Contents
Metabolite 3Z-PHYCOERYTHROBILIN
- common-name:
- (3z)-phycoerythrobilin
- smiles:
- cc=c1(c(c)c(nc1=cc4(=c(c)c(ccc([o-])=o)=c(c=c2(c(ccc([o-])=o)=c(c)c(=n2)c[ch]3(c(c)=c(c=c)c(=o)n3)))n4))=o)
- inchi-key:
- igjxaxffkkrfku-isrbknaysa-l
- molecular-weight:
- 584.671
