Difference between revisions of "R-COCLAURINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1121 == * common-name: ** d-myo-inositol 1,2-cyclic phosphate * smiles: ** c2(o)(c(o)c1(op([o-])(=o)oc1c(o)c(o)2)) * inchi-key: ** sx...") |
(Created page with "Category:metabolite == Metabolite R-COCLAURINE == * common-name: ** (r)-coclaurine * smiles: ** c3(cc1(=cc(oc)=c(o)c=c1[ch](cc2(=cc=c(o)c=c2))[n+]3)) * inchi-key: ** lvvkx...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite R-COCLAURINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** (r)-coclaurine |
* smiles: | * smiles: | ||
| − | ** | + | ** c3(cc1(=cc(oc)=c(o)c=c1[ch](cc2(=cc=c(o)c=c2))[n+]3)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** lvvkxrqzsruvpy-oahllokosa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 286.35 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-5141]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(r)-coclaurine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lvvkxrqzsruvpy-oahllokosa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=286.35}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite R-COCLAURINE
- common-name:
- (r)-coclaurine
- smiles:
- c3(cc1(=cc(oc)=c(o)c=c1[ch](cc2(=cc=c(o)c=c2))[n+]3))
- inchi-key:
- lvvkxrqzsruvpy-oahllokosa-o
- molecular-weight:
- 286.35
