Difference between revisions of "R-NORCOCLAURINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4201 == * common-name: ** n6-(δ2-isopentenyl)-adenosine 5'-triphosphate * smiles: ** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)...")
(Created page with "Category:metabolite == Metabolite CPD-7836 == * common-name: ** myristate * smiles: ** cccccccccccccc([o-])=o * inchi-key: ** tunfsrhwotwdnc-uhfffaoysa-m * molecular-weigh...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-4201 ==
+
== Metabolite CPD-7836 ==
 
* common-name:
 
* common-name:
** n6-(δ2-isopentenyl)-adenosine 5'-triphosphate
+
** myristate
 
* smiles:
 
* smiles:
** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)([o-])op(=o)([o-])o)([o-])=o)o)o))c=nc=23)))c
+
** cccccccccccccc([o-])=o
 
* inchi-key:
 
* inchi-key:
** oplvztyvquwkhb-sdbhatresa-k
+
** tunfsrhwotwdnc-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 572.278
+
** 227.366
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-4303]]
+
* [[RXN-10727]]
 +
* [[RXN-9626]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n6-(δ2-isopentenyl)-adenosine 5'-triphosphate}}
+
{{#set: common-name=myristate}}
{{#set: inchi-key=inchikey=oplvztyvquwkhb-sdbhatresa-k}}
+
{{#set: inchi-key=inchikey=tunfsrhwotwdnc-uhfffaoysa-m}}
{{#set: molecular-weight=572.278}}
+
{{#set: molecular-weight=227.366}}

Revision as of 11:13, 15 January 2021

Metabolite CPD-7836

  • common-name:
    • myristate
  • smiles:
    • cccccccccccccc([o-])=o
  • inchi-key:
    • tunfsrhwotwdnc-uhfffaoysa-m
  • molecular-weight:
    • 227.366

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality