Difference between revisions of "R-NORCOCLAURINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE == * common-name: ** (s)-2,3,4,5-tetrahydrodipicolinate * smiles: ** c1(cc(=nc(c1)c([o-])=o)c([o-])=...")
(Created page with "Category:metabolite == Metabolite R-NORCOCLAURINE == * common-name: ** (r)-norcoclaurine * smiles: ** c3(cc1(=cc(o)=c(o)c=c1[ch](cc2(=cc=c(o)c=c2))[n+]3)) * inchi-key: **...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE ==
+
== Metabolite R-NORCOCLAURINE ==
 
* common-name:
 
* common-name:
** (s)-2,3,4,5-tetrahydrodipicolinate
+
** (r)-norcoclaurine
 
* smiles:
 
* smiles:
** c1(cc(=nc(c1)c([o-])=o)c([o-])=o)
+
** c3(cc1(=cc(o)=c(o)c=c1[ch](cc2(=cc=c(o)c=c2))[n+]3))
 
* inchi-key:
 
* inchi-key:
** cxmbcxqhoxuceo-bypyzucnsa-l
+
** wzrcqwqrfzitdx-cqszacivsa-o
 
* molecular-weight:
 
* molecular-weight:
** 169.137
+
** 272.323
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14246]]
+
* [[RXN-5141]]
* [[RXN-7737]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14014]]
 
* [[RXN-14246]]
 
* [[RXN-7737]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-2,3,4,5-tetrahydrodipicolinate}}
+
{{#set: common-name=(r)-norcoclaurine}}
{{#set: inchi-key=inchikey=cxmbcxqhoxuceo-bypyzucnsa-l}}
+
{{#set: inchi-key=inchikey=wzrcqwqrfzitdx-cqszacivsa-o}}
{{#set: molecular-weight=169.137}}
+
{{#set: molecular-weight=272.323}}

Latest revision as of 11:11, 18 March 2021

Metabolite R-NORCOCLAURINE

  • common-name:
    • (r)-norcoclaurine
  • smiles:
    • c3(cc1(=cc(o)=c(o)c=c1[ch](cc2(=cc=c(o)c=c2))[n+]3))
  • inchi-key:
    • wzrcqwqrfzitdx-cqszacivsa-o
  • molecular-weight:
    • 272.323

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality