Difference between revisions of "RAD21-Cohesin-Subunits"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2108 == * common-name: ** (2e)-oct-2-enoyl-coa * smiles: ** cccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op...")
(Created page with "Category:metabolite == Metabolite RAD21-Cohesin-Subunits == * common-name: ** a rad21 cohesin subunit == Reaction(s) known to consume the compound == * RXN-11693 == Re...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-2108 ==
+
== Metabolite RAD21-Cohesin-Subunits ==
 
* common-name:
 
* common-name:
** (2e)-oct-2-enoyl-coa
+
** a rad21 cohesin subunit
* smiles:
 
** cccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
 
* inchi-key:
 
** cpsdnaxxkwvyiy-ntlmcjqisa-j
 
* molecular-weight:
 
** 887.685
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14229]]
+
* [[RXN-11693]]
* [[RXN-14276]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACOA80OR]]
 
* [[RXN-12669]]
 
* [[RXN-14229]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e)-oct-2-enoyl-coa}}
+
{{#set: common-name=a rad21 cohesin subunit}}
{{#set: inchi-key=inchikey=cpsdnaxxkwvyiy-ntlmcjqisa-j}}
 
{{#set: molecular-weight=887.685}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite RAD21-Cohesin-Subunits

  • common-name:
    • a rad21 cohesin subunit

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality