Difference between revisions of "RAD21-Cohesin-Subunits"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPDQT-37 == * common-name: ** 3-[(4'-methylthio)butyl]malate * smiles: ** csccccc(c(o)c(=o)[o-])c(=o)[o-] * inchi-key: ** zizldvklmyvmnx-...") |
(Created page with "Category:metabolite == Metabolite RAD21-Cohesin-Subunits == * common-name: ** a rad21 cohesin subunit == Reaction(s) known to consume the compound == * RXN-11693 == Re...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite RAD21-Cohesin-Subunits == |
* common-name: | * common-name: | ||
− | ** | + | ** a rad21 cohesin subunit |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-11693]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a rad21 cohesin subunit}} |
− | |||
− |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite RAD21-Cohesin-Subunits
- common-name:
- a rad21 cohesin subunit