Difference between revisions of "RAD21-Cohesin-Subunits"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2108 == * common-name: ** (2e)-oct-2-enoyl-coa * smiles: ** cccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op...") |
(Created page with "Category:metabolite == Metabolite CPDQT-37 == * common-name: ** 3-[(4'-methylthio)butyl]malate * smiles: ** csccccc(c(o)c(=o)[o-])c(=o)[o-] * inchi-key: ** zizldvklmyvmnx-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPDQT-37 == |
* common-name: | * common-name: | ||
| − | ** ( | + | ** 3-[(4'-methylthio)butyl]malate |
* smiles: | * smiles: | ||
| − | ** | + | ** csccccc(c(o)c(=o)[o-])c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zizldvklmyvmnx-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 234.267 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-18206]] |
| − | * [[ | + | * [[RXNQT-4168]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-18206]] | |
| − | * [[RXN- | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=( | + | {{#set: common-name=3-[(4'-methylthio)butyl]malate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zizldvklmyvmnx-uhfffaoysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=234.267}} |
Revision as of 13:08, 14 January 2021
Contents
Metabolite CPDQT-37
- common-name:
- 3-[(4'-methylthio)butyl]malate
- smiles:
- csccccc(c(o)c(=o)[o-])c(=o)[o-]
- inchi-key:
- zizldvklmyvmnx-uhfffaoysa-l
- molecular-weight:
- 234.267
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "3-[(4'-methylthio)butyl]malate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
