Difference between revisions of "RAD21-Cohesin-Subunits"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ17783 == * transcription-direction: ** negative * right-end-position: ** 253826 * left-end-position: ** 236141 * centisome-position: ** 92.31722...")
(Created page with "Category:metabolite == Metabolite CPD-17403 == * common-name: ** (2e,11z,17z)-14r-hydroxy-icosa-11,17-trienoyl-coa * smiles: ** ccc=cccc(o)cc=ccccccccc=cc(=o)sccnc(=o)ccnc...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ17783 ==
+
== Metabolite CPD-17403 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** (2e,11z,17z)-14r-hydroxy-icosa-11,17-trienoyl-coa
−
* right-end-position:
+
* smiles:
−
** 253826
+
** ccc=cccc(o)cc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
* left-end-position:
+
* inchi-key:
−
** 236141
+
** gccbkkqiemqvgw-pkayedjnsa-j
−
* centisome-position:
+
* molecular-weight:
−
** 92.31722   
+
** 1067.974
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN-16155]]
−
* [[CARBODEHYDRAT-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=(2e,11z,17z)-14r-hydroxy-icosa-11,17-trienoyl-coa}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=gccbkkqiemqvgw-pkayedjnsa-j}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=1067.974}}
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN0-5224]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6142]]
 
−
** '''10''' reactions found over '''13''' reactions in the full pathway
 
−
* [[PWY-7115]]
 
−
** '''9''' reactions found over '''10''' reactions in the full pathway
 
−
* [[PWYQT-4429]]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
* [[CYANCAT-PWY]]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-5744]]
 
−
** '''4''' reactions found over '''13''' reactions in the full pathway
 
−
* [[PWY-5789]]
 
−
** '''8''' reactions found over '''18''' reactions in the full pathway
 
−
* [[PWY-7117]]
 
−
** '''10''' reactions found over '''12''' reactions in the full pathway
 
−
* [[PWY-5743]]
 
−
** '''5''' reactions found over '''13''' reactions in the full pathway
 
−
* [[PWY-241]]
 
−
** '''5''' reactions found over '''6''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=253826}}
 
−
{{#set: left-end-position=236141}}
 
−
{{#set: centisome-position=92.31722    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=9}}
 

Revision as of 20:31, 18 December 2020

Metabolite CPD-17403

  • common-name:
    • (2e,11z,17z)-14r-hydroxy-icosa-11,17-trienoyl-coa
  • smiles:
    • ccc=cccc(o)cc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • gccbkkqiemqvgw-pkayedjnsa-j
  • molecular-weight:
    • 1067.974

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=RAD21-Cohesin-Subunits&oldid=46059"