Difference between revisions of "REDUCED-MENAQUINONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Fructose-BisPO4-Aldolase-Lysine == * common-name: ** [fructose-bisphosphate aldolase]-lysine == Reaction(s) known to consume the compound...") |
(Created page with "Category:metabolite == Metabolite CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P == * common-name: ** 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate * smiles: ** c(op(=o)([o-]...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P == |
* common-name: | * common-name: | ||
− | ** [ | + | ** 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate |
+ | * smiles: | ||
+ | ** c(op(=o)([o-])[o-])c(o)c(o)c(=o)cnc1(c=cc=cc(c(=o)[o-])=1) | ||
+ | * inchi-key: | ||
+ | ** qkmbynrmprkvto-mnovxskesa-k | ||
+ | * molecular-weight: | ||
+ | ** 346.21 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[IGPSYN-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[PRAISOM-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate}} |
+ | {{#set: inchi-key=inchikey=qkmbynrmprkvto-mnovxskesa-k}} | ||
+ | {{#set: molecular-weight=346.21}} |
Revision as of 18:58, 14 January 2021
Contents
Metabolite CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P
- common-name:
- 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate
- smiles:
- c(op(=o)([o-])[o-])c(o)c(o)c(=o)cnc1(c=cc=cc(c(=o)[o-])=1)
- inchi-key:
- qkmbynrmprkvto-mnovxskesa-k
- molecular-weight:
- 346.21