Difference between revisions of "REDUCED-MENAQUINONE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16993 RXN-16993] == * direction: ** reversible * ec-number: ** [http://enzyme.expasy.org/EC/1.1...") |
(Created page with "Category:metabolite == Metabolite REDUCED-MENAQUINONE == * common-name: ** menaquinol-8 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite REDUCED-MENAQUINONE == |
| − | * | + | * common-name: |
| − | ** | + | ** menaquinol-8 |
| − | * | + | * smiles: |
| − | ** | + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(=cc=cc=c1c(o)=2)) |
| − | == | + | * inchi-key: |
| − | + | ** oiezrvbfvpgodt-wqwycsgdsa-n | |
| − | == | + | * molecular-weight: |
| − | * | + | ** 719.144 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[ADOMET-DMK-METHYLTRANSFER-RXN]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | ** | + | {{#set: common-name=menaquinol-8}} |
| − | == | + | {{#set: inchi-key=inchikey=oiezrvbfvpgodt-wqwycsgdsa-n}} |
| − | == | + | {{#set: molecular-weight=719.144}} |
| − | * | ||
| − | == | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite REDUCED-MENAQUINONE
- common-name:
- menaquinol-8
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(=cc=cc=c1c(o)=2))
- inchi-key:
- oiezrvbfvpgodt-wqwycsgdsa-n
- molecular-weight:
- 719.144
