Difference between revisions of "RETINAL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ANTHRANILATE == * common-name: ** anthranilate * smiles: ** c(c1(c(=cc=cc=1)n))(=o)[o-] * inchi-key: ** rwzyaggxghygmb-uhfffaoysa-m * mol...") |
(Created page with "Category:metabolite == Metabolite RETINAL == * common-name: ** all-trans-retinal * smiles: ** cc(c=cc1(c(c)(c)cccc(c)=1))=cc=cc(c)=c[ch]=o * inchi-key: ** ncycyzxnizjoki-o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite RETINAL == |
* common-name: | * common-name: | ||
| − | ** | + | ** all-trans-retinal |
* smiles: | * smiles: | ||
| − | ** c( | + | ** cc(c=cc1(c(c)(c)cccc(c)=1))=cc=cc(c)=c[ch]=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ncycyzxnizjoki-ovsjkpmpsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 284.441 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RETINOL-DEHYDROGENASE-RXN]] |
| − | * [[ | + | * [[RXN-10841]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RETINOL-DEHYDROGENASE-RXN]] |
| − | * [[ | + | * [[RXN-10841]] |
| + | * [[RXN-11783]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=all-trans-retinal}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ncycyzxnizjoki-ovsjkpmpsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=284.441}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite RETINAL
- common-name:
- all-trans-retinal
- smiles:
- cc(c=cc1(c(c)(c)cccc(c)=1))=cc=cc(c)=c[ch]=o
- inchi-key:
- ncycyzxnizjoki-ovsjkpmpsa-n
- molecular-weight:
- 284.441
