Difference between revisions of "RH-Group"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8999 == * common-name: ** 5-(methylsulfanyl)-2,3-dioxopentyl 1-phosphate * smiles: ** csccc(=o)c(=o)cop([o-])(=o)[o-] * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite RH-Group == * common-name: ** an organic molecule == Reaction(s) known to consume the compound == * RXN-12615 * UNSPECIFIC-MONOOXYG...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite RH-Group == |
* common-name: | * common-name: | ||
− | ** | + | ** an organic molecule |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-12615]] | ||
+ | * [[UNSPECIFIC-MONOOXYGENASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an organic molecule}} |
− | |||
− |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite RH-Group
- common-name:
- an organic molecule