Difference between revisions of "RIBITOL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14420 == * common-name: ** icosatrienoyl-2-enoyl coa * smiles: ** ccc=ccc=ccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(...")
(Created page with "Category:metabolite == Metabolite ACYL-SN-GLYCEROL-3P == * common-name: ** a 1-acyl-sn-glycerol 3-phosphate == Reaction(s) known to consume the compound == * 1-ACYLGLYCE...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14420 ==
+
== Metabolite ACYL-SN-GLYCEROL-3P ==
 
* common-name:
 
* common-name:
** icosatrienoyl-2-enoyl coa
+
** a 1-acyl-sn-glycerol 3-phosphate
* smiles:
 
** ccc=ccc=ccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** yjkoikylhsmlhc-atrrwjjysa-j
 
* molecular-weight:
 
** 1049.959
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[1-ACYLGLYCEROL-3-P-ACYLTRANSFER-RXN]]
 +
* [[RXN-16032]]
 +
* [[RXN-16066]]
 +
* [[RXN-1623]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13001]]
+
* [[RXN-10462]]
 +
* [[RXN-1381]]
 +
* [[RXN-16066]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=icosatrienoyl-2-enoyl coa}}
+
{{#set: common-name=a 1-acyl-sn-glycerol 3-phosphate}}
{{#set: inchi-key=inchikey=yjkoikylhsmlhc-atrrwjjysa-j}}
 
{{#set: molecular-weight=1049.959}}
 

Revision as of 15:29, 5 January 2021

Metabolite ACYL-SN-GLYCEROL-3P

  • common-name:
    • a 1-acyl-sn-glycerol 3-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality