Difference between revisions of "RIBOFLAVIN"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ01771 == * transcription-direction: ** negative * right-end-position: ** 141234 * left-end-position: ** 134493 * centisome-position: ** 92.10713...") |
(Created page with "Category:metabolite == Metabolite RIBOFLAVIN == * common-name: ** riboflavin * smiles: ** cc1(c=c3(c(=cc(c)=1)n(cc(o)c(o)c(o)co)c2(c(c(=o)[n-]c(=o)n=2)=n3))) * inchi-key:...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite RIBOFLAVIN == |
− | * | + | * common-name: |
− | ** | + | ** riboflavin |
− | * | + | * smiles: |
− | ** | + | ** cc1(c=c3(c(=cc(c)=1)n(cc(o)c(o)c(o)co)c2(c(c(=o)[n-]c(=o)n=2)=n3))) |
− | + | * inchi-key: | |
− | + | ** aunganrzjhbgpy-scrdcrapsa-m | |
− | + | * molecular-weight: | |
− | + | ** 375.36 | |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[ARPT]] | |
− | == | + | * [[NADPH-DEHYDROGENASE-FLAVIN-RXN]] |
− | * | + | * [[RIBOFLAVINKIN-RXN]] |
− | + | * [[RXN-12445]] | |
− | ** | + | == Reaction(s) known to produce the compound == |
− | + | * [[RIBOFLAVIN-SYN-RXN]] | |
− | + | * [[RXN0-5187]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=riboflavin}} | |
− | * | + | {{#set: inchi-key=inchikey=aunganrzjhbgpy-scrdcrapsa-m}} |
− | + | {{#set: molecular-weight=375.36}} | |
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | == | ||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite RIBOFLAVIN
- common-name:
- riboflavin
- smiles:
- cc1(c=c3(c(=cc(c)=1)n(cc(o)c(o)c(o)co)c2(c(c(=o)[n-]c(=o)n=2)=n3)))
- inchi-key:
- aunganrzjhbgpy-scrdcrapsa-m
- molecular-weight:
- 375.36