Difference between revisions of "RIBOFLAVIN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14736 == * common-name: ** l-kynurenine * smiles: ** c(=o)([o-])c([n+])cc(=o)c1(=c(n)c=cc=c1) * inchi-key: ** ygpsjzoedvaxab-qmmmgpob...") |
(Created page with "Category:metabolite == Metabolite RIBOFLAVIN == * common-name: ** riboflavin * smiles: ** cc1(c=c3(c(=cc(c)=1)n(cc(o)c(o)c(o)co)c2(c(c(=o)[n-]c(=o)n=2)=n3))) * inchi-key:...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite RIBOFLAVIN == |
* common-name: | * common-name: | ||
− | ** | + | ** riboflavin |
* smiles: | * smiles: | ||
− | ** c(=o)( | + | ** cc1(c=c3(c(=cc(c)=1)n(cc(o)c(o)c(o)co)c2(c(c(=o)[n-]c(=o)n=2)=n3))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** aunganrzjhbgpy-scrdcrapsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 375.36 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[ARPT]] |
− | * [[ | + | * [[NADPH-DEHYDROGENASE-FLAVIN-RXN]] |
+ | * [[RIBOFLAVINKIN-RXN]] | ||
+ | * [[RXN-12445]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RIBOFLAVIN-SYN-RXN]] |
− | * [[ | + | * [[RXN0-5187]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=riboflavin}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=aunganrzjhbgpy-scrdcrapsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=375.36}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite RIBOFLAVIN
- common-name:
- riboflavin
- smiles:
- cc1(c=c3(c(=cc(c)=1)n(cc(o)c(o)c(o)co)c2(c(c(=o)[n-]c(=o)n=2)=n3)))
- inchi-key:
- aunganrzjhbgpy-scrdcrapsa-m
- molecular-weight:
- 375.36