Difference between revisions of "RIBOFLAVIN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite His-tRNA-Adenosine4 == * common-name: ** an adenosine4 in trnahis == Reaction(s) known to consume the compound == * RXN-12479 == Reac...")
(Created page with "Category:metabolite == Metabolite RIBOFLAVIN == * common-name: ** riboflavin * smiles: ** cc1(c=c3(c(=cc(c)=1)n(cc(o)c(o)c(o)co)c2(c(c(=o)[n-]c(=o)n=2)=n3))) * inchi-key:...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite His-tRNA-Adenosine4 ==
+
== Metabolite RIBOFLAVIN ==
 
* common-name:
 
* common-name:
** an adenosine4 in trnahis
+
** riboflavin
 +
* smiles:
 +
** cc1(c=c3(c(=cc(c)=1)n(cc(o)c(o)c(o)co)c2(c(c(=o)[n-]c(=o)n=2)=n3)))
 +
* inchi-key:
 +
** aunganrzjhbgpy-scrdcrapsa-m
 +
* molecular-weight:
 +
** 375.36
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12479]]
+
* [[ARPT]]
 +
* [[NADPH-DEHYDROGENASE-FLAVIN-RXN]]
 +
* [[RIBOFLAVINKIN-RXN]]
 +
* [[RXN-12445]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RIBOFLAVIN-SYN-RXN]]
 +
* [[RXN0-5187]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an adenosine4 in trnahis}}
+
{{#set: common-name=riboflavin}}
 +
{{#set: inchi-key=inchikey=aunganrzjhbgpy-scrdcrapsa-m}}
 +
{{#set: molecular-weight=375.36}}

Latest revision as of 11:15, 18 March 2021

Metabolite RIBOFLAVIN

  • common-name:
    • riboflavin
  • smiles:
    • cc1(c=c3(c(=cc(c)=1)n(cc(o)c(o)c(o)co)c2(c(c(=o)[n-]c(=o)n=2)=n3)))
  • inchi-key:
    • aunganrzjhbgpy-scrdcrapsa-m
  • molecular-weight:
    • 375.36

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality