Difference between revisions of "RIBOFLAVIN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14736 == * common-name: ** l-kynurenine * smiles: ** c(=o)([o-])c([n+])cc(=o)c1(=c(n)c=cc=c1) * inchi-key: ** ygpsjzoedvaxab-qmmmgpob...") |
(Created page with "Category:metabolite == Metabolite His-tRNA-Adenosine4 == * common-name: ** an adenosine4 in trnahis == Reaction(s) known to consume the compound == * RXN-12479 == Reac...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite His-tRNA-Adenosine4 == |
* common-name: | * common-name: | ||
| − | ** | + | ** an adenosine4 in trnahis |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-12479]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an adenosine4 in trnahis}} |
| − | |||
| − | |||
Revision as of 18:56, 14 January 2021
Contents
Metabolite His-tRNA-Adenosine4
- common-name:
- an adenosine4 in trnahis
